C17H24N4O4 — CID 112531632
methyl 1-[2-[(dimethylcarbamoylamino)methyl]pyridine-4-carbonyl]piperidine-3-carboxylate (PubChem CID 112531632) has the molecular formula C17H24N4O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is methyl 1-[2-[(dimethylcarbamoylamino)methyl]pyridine-4-carbonyl]piperidine-3-carboxylate.
| Compound Name | methyl 1-[2-[(dimethylcarbamoylamino)methyl]pyridine-4-carbonyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 112531632 |
| Molecular Formula | C17H24N4O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | methyl 1-[2-[(dimethylcarbamoylamino)methyl]pyridine-4-carbonyl]piperidine-3-carboxylate |
| SMILES | COC(=O)C1CCCN(C(=O)c2ccnc(CNC(=O)N(C)C)c2)C1 |
| InChI | InChI=1S/C17H24N4O4/c1-20(2)17(24)19-10-14-9-12(6-7-18-14)15(22)21-8-4-5-13(11-21)16(23)25-3/h6-7,9,13H,4-5,8,10-11H2,1-3H3,(H,19,24) |
| InChIKey | SIFYEKLMUDVNCI-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |