C14H15F2NO3 — CID 78919478
methyl (3S)-1-(3,4-difluorobenzoyl)piperidine-3-carboxylate (PubChem CID 78919478) has the molecular formula C14H15F2NO3 and a molecular weight of 283.27 g/mol. Its IUPAC name is methyl (3S)-1-(3,4-difluorobenzoyl)piperidine-3-carboxylate.
| Compound Name | methyl (3S)-1-(3,4-difluorobenzoyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 78919478 |
| Molecular Formula | C14H15F2NO3 |
| Molecular Weight | 283.27 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | methyl (3S)-1-(3,4-difluorobenzoyl)piperidine-3-carboxylate |
| SMILES | COC(=O)[C@H]1CCCN(C(=O)c2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C14H15F2NO3/c1-20-14(19)10-3-2-6-17(8-10)13(18)9-4-5-11(15)12(16)7-9/h4-5,7,10H,2-3,6,8H2,1H3/t10-/m0/s1 |
| InChIKey | RFXSXZPWXMJPNP-JTQLQIEISA-N |
| XLogP | 1.99 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.27 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |