C15H18ClNO3 — CID 103760234
methyl (3S)-1-(4-chloro-3-methylbenzoyl)piperidine-3-carboxylate (PubChem CID 103760234) has the molecular formula C15H18ClNO3 and a molecular weight of 295.77 g/mol. Its IUPAC name is methyl (3S)-1-(4-chloro-3-methylbenzoyl)piperidine-3-carboxylate.
| Compound Name | methyl (3S)-1-(4-chloro-3-methylbenzoyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 103760234 |
| Molecular Formula | C15H18ClNO3 |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | methyl (3S)-1-(4-chloro-3-methylbenzoyl)piperidine-3-carboxylate |
| SMILES | COC(=O)[C@H]1CCCN(C(=O)c2ccc(Cl)c(C)c2)C1 |
| InChI | InChI=1S/C15H18ClNO3/c1-10-8-11(5-6-13(10)16)14(18)17-7-3-4-12(9-17)15(19)20-2/h5-6,8,12H,3-4,7,9H2,1-2H3/t12-/m0/s1 |
| InChIKey | ACWLFCKLWOEZBQ-LBPRGKRZSA-N |
| XLogP | 2.67 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |