C14H14F3NO3 — CID 63188918
methyl 1-(3,4,5-trifluorobenzoyl)piperidine-2-carboxylate (PubChem CID 63188918) has the molecular formula C14H14F3NO3 and a molecular weight of 301.26 g/mol. Its IUPAC name is methyl 1-(3,4,5-trifluorobenzoyl)piperidine-2-carboxylate.
| Compound Name | methyl 1-(3,4,5-trifluorobenzoyl)piperidine-2-carboxylate |
|---|---|
| PubChem CID | 63188918 |
| Molecular Formula | C14H14F3NO3 |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | methyl 1-(3,4,5-trifluorobenzoyl)piperidine-2-carboxylate |
| SMILES | COC(=O)C1CCCCN1C(=O)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C14H14F3NO3/c1-21-14(20)11-4-2-3-5-18(11)13(19)8-6-9(15)12(17)10(16)7-8/h6-7,11H,2-5H2,1H3 |
| InChIKey | HBEPGOBHYRGTHG-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|