C15H16F3NO3 — CID 25465302
methyl (2R)-1-[4-(trifluoromethyl)benzoyl]piperidine-2-carboxylate (PubChem CID 25465302) has the molecular formula C15H16F3NO3 and a molecular weight of 315.29 g/mol. Its IUPAC name is methyl (2R)-1-[4-(trifluoromethyl)benzoyl]piperidine-2-carboxylate.
| Compound Name | methyl (2R)-1-[4-(trifluoromethyl)benzoyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 25465302 |
| Molecular Formula | C15H16F3NO3 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | methyl (2R)-1-[4-(trifluoromethyl)benzoyl]piperidine-2-carboxylate |
| SMILES | COC(=O)[C@H]1CCCCN1C(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H16F3NO3/c1-22-14(21)12-4-2-3-9-19(12)13(20)10-5-7-11(8-6-10)15(16,17)18/h5-8,12H,2-4,9H2,1H3/t12-/m1/s1 |
| InChIKey | WFAAKIYVLTULDT-GFCCVEGCSA-N |
| XLogP | 2.87 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |