C14H16INO4 — CID 104627850
methyl 1-(3-hydroxy-4-iodobenzoyl)piperidine-2-carboxylate (PubChem CID 104627850) has the molecular formula C14H16INO4 and a molecular weight of 389.19 g/mol. Its IUPAC name is methyl 1-(3-hydroxy-4-iodobenzoyl)piperidine-2-carboxylate.
| Compound Name | methyl 1-(3-hydroxy-4-iodobenzoyl)piperidine-2-carboxylate |
|---|---|
| PubChem CID | 104627850 |
| Molecular Formula | C14H16INO4 |
| Molecular Weight | 389.19 g/mol |
| Exact Mass | 389.01 |
| IUPAC Name | methyl 1-(3-hydroxy-4-iodobenzoyl)piperidine-2-carboxylate |
| SMILES | COC(=O)C1CCCCN1C(=O)c1ccc(I)c(O)c1 |
| InChI | InChI=1S/C14H16INO4/c1-20-14(19)11-4-2-3-7-16(11)13(18)9-5-6-10(15)12(17)8-9/h5-6,8,11,17H,2-4,7H2,1H3 |
| InChIKey | ASRSOHOOZJBOFH-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.19 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|