C15H18INO4 — CID 104627941
ethyl 1-(3-hydroxy-4-iodobenzoyl)piperidine-2-carboxylate (PubChem CID 104627941) has the molecular formula C15H18INO4 and a molecular weight of 403.22 g/mol. Its IUPAC name is ethyl 1-(3-hydroxy-4-iodobenzoyl)piperidine-2-carboxylate.
| Compound Name | ethyl 1-(3-hydroxy-4-iodobenzoyl)piperidine-2-carboxylate |
|---|---|
| PubChem CID | 104627941 |
| Molecular Formula | C15H18INO4 |
| Molecular Weight | 403.22 g/mol |
| Exact Mass | 403.03 |
| IUPAC Name | ethyl 1-(3-hydroxy-4-iodobenzoyl)piperidine-2-carboxylate |
| SMILES | CCOC(=O)C1CCCCN1C(=O)c1ccc(I)c(O)c1 |
| InChI | InChI=1S/C15H18INO4/c1-2-21-15(20)12-5-3-4-8-17(12)14(19)10-6-7-11(16)13(18)9-10/h6-7,9,12,18H,2-5,8H2,1H3 |
| InChIKey | JKGCUDPFPCXNBC-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.22 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|