C15H18ClNO4 — CID 43648357
ethyl 1-(4-chloro-2-hydroxybenzoyl)piperidine-2-carboxylate (PubChem CID 43648357) has the molecular formula C15H18ClNO4 and a molecular weight of 311.77 g/mol. Its IUPAC name is ethyl 1-(4-chloro-2-hydroxybenzoyl)piperidine-2-carboxylate.
| Compound Name | ethyl 1-(4-chloro-2-hydroxybenzoyl)piperidine-2-carboxylate |
|---|---|
| PubChem CID | 43648357 |
| Molecular Formula | C15H18ClNO4 |
| Molecular Weight | 311.77 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | ethyl 1-(4-chloro-2-hydroxybenzoyl)piperidine-2-carboxylate |
| SMILES | CCOC(=O)C1CCCCN1C(=O)c1ccc(Cl)cc1O |
| InChI | InChI=1S/C15H18ClNO4/c1-2-21-15(20)12-5-3-4-8-17(12)14(19)11-7-6-10(16)9-13(11)18/h6-7,9,12,18H,2-5,8H2,1H3 |
| InChIKey | SXCLJNAICVGLIF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.77 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |