C16H20FNO4S — CID 119210624
2-[4-[3-(3-fluoro-4-methoxyphenyl)propanoyl]thiomorpholin-3-yl]acetic acid (PubChem CID 119210624) has the molecular formula C16H20FNO4S and a molecular weight of 341.40 g/mol. Its IUPAC name is 2-[4-[3-(3-fluoro-4-methoxyphenyl)propanoyl]thiomorpholin-3-yl]acetic acid.
| Compound Name | 2-[4-[3-(3-fluoro-4-methoxyphenyl)propanoyl]thiomorpholin-3-yl]acetic acid |
|---|---|
| PubChem CID | 119210624 |
| Molecular Formula | C16H20FNO4S |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | 2-[4-[3-(3-fluoro-4-methoxyphenyl)propanoyl]thiomorpholin-3-yl]acetic acid |
| SMILES | COc1ccc(CCC(=O)N2CCSCC2CC(=O)O)cc1F |
| InChI | InChI=1S/C16H20FNO4S/c1-22-14-4-2-11(8-13(14)17)3-5-15(19)18-6-7-23-10-12(18)9-16(20)21/h2,4,8,12H,3,5-7,9-10H2,1H3,(H,20,21) |
| InChIKey | RGSXTRHZTXYCMC-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.40 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |