C17H23NO5S2 — CID 120520746
2-[4-[3-(4-ethylsulfonylphenyl)propanoyl]thiomorpholin-3-yl]acetic acid (PubChem CID 120520746) has the molecular formula C17H23NO5S2 and a molecular weight of 385.51 g/mol. Its IUPAC name is 2-[4-[3-(4-ethylsulfonylphenyl)propanoyl]thiomorpholin-3-yl]acetic acid.
| Compound Name | 2-[4-[3-(4-ethylsulfonylphenyl)propanoyl]thiomorpholin-3-yl]acetic acid |
|---|---|
| PubChem CID | 120520746 |
| Molecular Formula | C17H23NO5S2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 2-[4-[3-(4-ethylsulfonylphenyl)propanoyl]thiomorpholin-3-yl]acetic acid |
| SMILES | CCS(=O)(=O)c1ccc(CCC(=O)N2CCSCC2CC(=O)O)cc1 |
| InChI | InChI=1S/C17H23NO5S2/c1-2-25(22,23)15-6-3-13(4-7-15)5-8-16(19)18-9-10-24-12-14(18)11-17(20)21/h3-4,6-7,14H,2,5,8-12H2,1H3,(H,20,21) |
| InChIKey | JWUPAGZMDNXSIX-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |