About 2-[4-[3-(1,3-thiazol-4-yl)propanoyl]thiomorpholin-3-yl]acetic acid
2-[4-[3-(1,3-thiazol-4-yl)propanoyl]thiomorpholin-3-yl]acetic acid (PubChem CID 119210279) has the molecular formula C12H16N2O3S2
and a molecular weight of 300.40 g/mol. Its IUPAC name is 2-[4-[3-(1,3-thiazol-4-yl)propanoyl]thiomorpholin-3-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[4-[3-(1,3-thiazol-4-yl)propanoyl]thiomorpholin-3-yl]acetic acid |
| PubChem CID | 119210279 |
| Molecular Formula | C12H16N2O3S2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 2-[4-[3-(1,3-thiazol-4-yl)propanoyl]thiomorpholin-3-yl]acetic acid |
| SMILES | O=C(O)CC1CSCCN1C(=O)CCc1cscn1 |
| InChI | InChI=1S/C12H16N2O3S2/c15-11(2-1-9-6-19-8-13-9)14-3-4-18-7-10(14)5-12(16)17/h6,8,10H,1-5,7H2,(H,16,17) |
| InChIKey | HECLVFYGVMRTDM-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-[3-(1,3-thiazol-4-yl)propanoyl]thiomorpholin-3-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[3-(1,3-thiazol-4-yl)propanoyl]thiomorpholin-3-yl]acetic acid?
The IUPAC name of 2-[4-[3-(1,3-thiazol-4-yl)propanoyl]thiomorpholin-3-yl]acetic acid (CID 119210279) is 2-[4-[3-(1,3-thiazol-4-yl)propanoyl]thiomorpholin-3-yl]acetic acid.
What is the SMILES notation for 2-[4-[3-(1,3-thiazol-4-yl)propanoyl]thiomorpholin-3-yl]acetic acid?
The canonical SMILES for 2-[4-[3-(1,3-thiazol-4-yl)propanoyl]thiomorpholin-3-yl]acetic acid is O=C(O)CC1CSCCN1C(=O)CCc1cscn1.
What is the InChIKey of 2-[4-[3-(1,3-thiazol-4-yl)propanoyl]thiomorpholin-3-yl]acetic acid?
The InChIKey is HECLVFYGVMRTDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O3S2/c15-11(2-1-9-6-19-8-13-9)14-3-4-18-7-10(14)5-12(16)17/h6,8,10H,1-5,7H2,(H,16,17).
What are the key properties of 2-[4-[3-(1,3-thiazol-4-yl)propanoyl]thiomorpholin-3-yl]acetic acid?
2-[4-[3-(1,3-thiazol-4-yl)propanoyl]thiomorpholin-3-yl]acetic acid has a molecular weight of 300.40 g/mol, XLogP of 1.49, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[3-(1,3-thiazol-4-yl)propanoyl]thiomorpholin-3-yl]acetic acid is sourced from PubChem (CID 119210279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).