C17H22N2O4S — CID 126817604
N-(cyclopropylmethyl)-3-(3-methyl-4-oxopiperidine-1-carbonyl)benzenesulfonamide (PubChem CID 126817604) has the molecular formula C17H22N2O4S and a molecular weight of 350.44 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-3-(3-methyl-4-oxopiperidine-1-carbonyl)benzenesulfonamide.
| Compound Name | N-(cyclopropylmethyl)-3-(3-methyl-4-oxopiperidine-1-carbonyl)benzenesulfonamide |
|---|---|
| PubChem CID | 126817604 |
| Molecular Formula | C17H22N2O4S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | N-(cyclopropylmethyl)-3-(3-methyl-4-oxopiperidine-1-carbonyl)benzenesulfonamide |
| SMILES | CC1CN(C(=O)c2cccc(S(=O)(=O)NCC3CC3)c2)CCC1=O |
| InChI | InChI=1S/C17H22N2O4S/c1-12-11-19(8-7-16(12)20)17(21)14-3-2-4-15(9-14)24(22,23)18-10-13-5-6-13/h2-4,9,12-13,18H,5-8,10-11H2,1H3 |
| InChIKey | LQIVFNKVIPMUHL-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |