C18H26N2O3S — CID 55655065
N-(cyclopropylmethyl)-3-(3-ethylpiperidine-1-carbonyl)benzenesulfonamide (PubChem CID 55655065) has the molecular formula C18H26N2O3S and a molecular weight of 350.48 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-3-(3-ethylpiperidine-1-carbonyl)benzenesulfonamide.
| Compound Name | N-(cyclopropylmethyl)-3-(3-ethylpiperidine-1-carbonyl)benzenesulfonamide |
|---|---|
| PubChem CID | 55655065 |
| Molecular Formula | C18H26N2O3S |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | N-(cyclopropylmethyl)-3-(3-ethylpiperidine-1-carbonyl)benzenesulfonamide |
| SMILES | CCC1CCCN(C(=O)c2cccc(S(=O)(=O)NCC3CC3)c2)C1 |
| InChI | InChI=1S/C18H26N2O3S/c1-2-14-5-4-10-20(13-14)18(21)16-6-3-7-17(11-16)24(22,23)19-12-15-8-9-15/h3,6-7,11,14-15,19H,2,4-5,8-10,12-13H2,1H3 |
| InChIKey | PVLHGIWXMJTUQS-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |