C15H17FN2O5S — CID 119259135
1-[3-(cyclopropylsulfamoyl)benzoyl]-3-fluoropyrrolidine-3-carboxylic acid (PubChem CID 119259135) has the molecular formula C15H17FN2O5S and a molecular weight of 356.38 g/mol. Its IUPAC name is 1-[3-(cyclopropylsulfamoyl)benzoyl]-3-fluoropyrrolidine-3-carboxylic acid.
| Compound Name | 1-[3-(cyclopropylsulfamoyl)benzoyl]-3-fluoropyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 119259135 |
| Molecular Formula | C15H17FN2O5S |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 1-[3-(cyclopropylsulfamoyl)benzoyl]-3-fluoropyrrolidine-3-carboxylic acid |
| SMILES | O=C(c1cccc(S(=O)(=O)NC2CC2)c1)N1CCC(F)(C(=O)O)C1 |
| InChI | InChI=1S/C15H17FN2O5S/c16-15(14(20)21)6-7-18(9-15)13(19)10-2-1-3-12(8-10)24(22,23)17-11-4-5-11/h1-3,8,11,17H,4-7,9H2,(H,20,21) |
| InChIKey | GWFPPMCPCJYRSI-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |