C17H23N3O5S — CID 109062305
ethyl 4-[3-(cyclopropylcarbamoyl)phenyl]sulfonylpiperazine-1-carboxylate (PubChem CID 109062305) has the molecular formula C17H23N3O5S and a molecular weight of 381.45 g/mol. Its IUPAC name is ethyl 4-[3-(cyclopropylcarbamoyl)phenyl]sulfonylpiperazine-1-carboxylate.
| Compound Name | ethyl 4-[3-(cyclopropylcarbamoyl)phenyl]sulfonylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 109062305 |
| Molecular Formula | C17H23N3O5S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | ethyl 4-[3-(cyclopropylcarbamoyl)phenyl]sulfonylpiperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(S(=O)(=O)c2cccc(C(=O)NC3CC3)c2)CC1 |
| InChI | InChI=1S/C17H23N3O5S/c1-2-25-17(22)19-8-10-20(11-9-19)26(23,24)15-5-3-4-13(12-15)16(21)18-14-6-7-14/h3-5,12,14H,2,6-11H2,1H3,(H,18,21) |
| InChIKey | TWEAAXIBTYYKRG-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |