C24H30ClN3O4S — CID 43005842
N-[2-(2-chlorophenyl)-2-pyrrolidin-1-ylethyl]-3-(oxolan-2-ylmethylsulfamoyl)benzamide (PubChem CID 43005842) has the molecular formula C24H30ClN3O4S and a molecular weight of 492.04 g/mol. Its IUPAC name is N-[2-(2-chlorophenyl)-2-pyrrolidin-1-ylethyl]-3-(oxolan-2-ylmethylsulfamoyl)benzamide.
| Compound Name | N-[2-(2-chlorophenyl)-2-pyrrolidin-1-ylethyl]-3-(oxolan-2-ylmethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 43005842 |
| Molecular Formula | C24H30ClN3O4S |
| Molecular Weight | 492.04 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | N-[2-(2-chlorophenyl)-2-pyrrolidin-1-ylethyl]-3-(oxolan-2-ylmethylsulfamoyl)benzamide |
| SMILES | O=C(NCC(c1ccccc1Cl)N1CCCC1)c1cccc(S(=O)(=O)NCC2CCCO2)c1 |
| InChI | InChI=1S/C24H30ClN3O4S/c25-22-11-2-1-10-21(22)23(28-12-3-4-13-28)17-26-24(29)18-7-5-9-20(15-18)33(30,31)27-16-19-8-6-14-32-19/h1-2,5,7,9-11,15,19,23,27H,3-4,6,8,12-14,16-17H2,(H,26,29) |
| InChIKey | XDGQSRBPGOTZRH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.04 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |