C25H26N2O4S — CID 17147844
N-[4-(oxolan-2-ylmethylsulfamoyl)phenyl]-2,2-diphenylacetamide (PubChem CID 17147844) has the molecular formula C25H26N2O4S and a molecular weight of 450.56 g/mol. Its IUPAC name is N-[4-(oxolan-2-ylmethylsulfamoyl)phenyl]-2,2-diphenylacetamide.
| Compound Name | N-[4-(oxolan-2-ylmethylsulfamoyl)phenyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 17147844 |
| Molecular Formula | C25H26N2O4S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | N-[4-(oxolan-2-ylmethylsulfamoyl)phenyl]-2,2-diphenylacetamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)NCC2CCCO2)cc1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H26N2O4S/c28-25(24(19-8-3-1-4-9-19)20-10-5-2-6-11-20)27-21-13-15-23(16-14-21)32(29,30)26-18-22-12-7-17-31-22/h1-6,8-11,13-16,22,24,26H,7,12,17-18H2,(H,27,28) |
| InChIKey | XOSANCNLNHPWLH-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |