C24H31N3O5S — CID 41300861
3-(2-ethylbutanoylamino)-N-[4-[[(2R)-oxolan-2-yl]methylsulfamoyl]phenyl]benzamide (PubChem CID 41300861) has the molecular formula C24H31N3O5S and a molecular weight of 473.60 g/mol. Its IUPAC name is 3-(2-ethylbutanoylamino)-N-[4-[[(2R)-oxolan-2-yl]methylsulfamoyl]phenyl]benzamide.
| Compound Name | 3-(2-ethylbutanoylamino)-N-[4-[[(2R)-oxolan-2-yl]methylsulfamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 41300861 |
| Molecular Formula | C24H31N3O5S |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | 3-(2-ethylbutanoylamino)-N-[4-[[(2R)-oxolan-2-yl]methylsulfamoyl]phenyl]benzamide |
| SMILES | CCC(CC)C(=O)Nc1cccc(C(=O)Nc2ccc(S(=O)(=O)NC[C@H]3CCCO3)cc2)c1 |
| InChI | InChI=1S/C24H31N3O5S/c1-3-17(4-2)23(28)27-20-8-5-7-18(15-20)24(29)26-19-10-12-22(13-11-19)33(30,31)25-16-21-9-6-14-32-21/h5,7-8,10-13,15,17,21,25H,3-4,6,9,14,16H2,1-2H3,(H,26,29)(H,27,28)/t21-/m1/s1 |
| InChIKey | UJHUFPUSZVGPRQ-OAQYLSRUSA-N |
| XLogP | 3.77 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |