C19H20F2N2O5S — CID 55849060
N-[3-(difluoromethoxy)phenyl]-4-(oxolan-2-ylmethylsulfamoyl)benzamide (PubChem CID 55849060) has the molecular formula C19H20F2N2O5S and a molecular weight of 426.44 g/mol. Its IUPAC name is N-[3-(difluoromethoxy)phenyl]-4-(oxolan-2-ylmethylsulfamoyl)benzamide.
| Compound Name | N-[3-(difluoromethoxy)phenyl]-4-(oxolan-2-ylmethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 55849060 |
| Molecular Formula | C19H20F2N2O5S |
| Molecular Weight | 426.44 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | N-[3-(difluoromethoxy)phenyl]-4-(oxolan-2-ylmethylsulfamoyl)benzamide |
| SMILES | O=C(Nc1cccc(OC(F)F)c1)c1ccc(S(=O)(=O)NCC2CCCO2)cc1 |
| InChI | InChI=1S/C19H20F2N2O5S/c20-19(21)28-15-4-1-3-14(11-15)23-18(24)13-6-8-17(9-7-13)29(25,26)22-12-16-5-2-10-27-16/h1,3-4,6-9,11,16,19,22H,2,5,10,12H2,(H,23,24) |
| InChIKey | YHPUOPAHQKSCEI-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.44 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |