C22H25N3O5S — CID 41119372
4-[[(2R)-oxolan-2-yl]methylsulfamoyl]-N-[3-(2-oxopyrrolidin-1-yl)phenyl]benzamide (PubChem CID 41119372) has the molecular formula C22H25N3O5S and a molecular weight of 443.53 g/mol. Its IUPAC name is 4-[[(2R)-oxolan-2-yl]methylsulfamoyl]-N-[3-(2-oxopyrrolidin-1-yl)phenyl]benzamide.
| Compound Name | 4-[[(2R)-oxolan-2-yl]methylsulfamoyl]-N-[3-(2-oxopyrrolidin-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 41119372 |
| Molecular Formula | C22H25N3O5S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 4-[[(2R)-oxolan-2-yl]methylsulfamoyl]-N-[3-(2-oxopyrrolidin-1-yl)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(N2CCCC2=O)c1)c1ccc(S(=O)(=O)NC[C@H]2CCCO2)cc1 |
| InChI | InChI=1S/C22H25N3O5S/c26-21-7-2-12-25(21)18-5-1-4-17(14-18)24-22(27)16-8-10-20(11-9-16)31(28,29)23-15-19-6-3-13-30-19/h1,4-5,8-11,14,19,23H,2-3,6-7,12-13,15H2,(H,24,27)/t19-/m1/s1 |
| InChIKey | IEFYSOOEGKZLEC-LJQANCHMSA-N |
| XLogP | 2.52 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |