C24H32N4O4S — CID 42305435
N-[4-(4-ethylpiperazin-1-yl)phenyl]-4-[[(2S)-oxolan-2-yl]methylsulfamoyl]benzamide (PubChem CID 42305435) has the molecular formula C24H32N4O4S and a molecular weight of 472.61 g/mol. Its IUPAC name is N-[4-(4-ethylpiperazin-1-yl)phenyl]-4-[[(2S)-oxolan-2-yl]methylsulfamoyl]benzamide.
| Compound Name | N-[4-(4-ethylpiperazin-1-yl)phenyl]-4-[[(2S)-oxolan-2-yl]methylsulfamoyl]benzamide |
|---|---|
| PubChem CID | 42305435 |
| Molecular Formula | C24H32N4O4S |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | N-[4-(4-ethylpiperazin-1-yl)phenyl]-4-[[(2S)-oxolan-2-yl]methylsulfamoyl]benzamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)c3ccc(S(=O)(=O)NC[C@@H]4CCCO4)cc3)cc2)CC1 |
| InChI | InChI=1S/C24H32N4O4S/c1-2-27-13-15-28(16-14-27)21-9-7-20(8-10-21)26-24(29)19-5-11-23(12-6-19)33(30,31)25-18-22-4-3-17-32-22/h5-12,22,25H,2-4,13-18H2,1H3,(H,26,29)/t22-/m0/s1 |
| InChIKey | DEHNVIIYRHLRBG-QFIPXVFZSA-N |
| XLogP | 2.54 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|