C24H32N2O7S — CID 3930366
3,4,5-triethoxy-N-[4-(oxolan-2-ylmethylsulfamoyl)phenyl]benzamide (PubChem CID 3930366) has the molecular formula C24H32N2O7S and a molecular weight of 492.59 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-[4-(oxolan-2-ylmethylsulfamoyl)phenyl]benzamide.
| Compound Name | 3,4,5-triethoxy-N-[4-(oxolan-2-ylmethylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 3930366 |
| Molecular Formula | C24H32N2O7S |
| Molecular Weight | 492.59 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | 3,4,5-triethoxy-N-[4-(oxolan-2-ylmethylsulfamoyl)phenyl]benzamide |
| SMILES | CCOc1cc(C(=O)Nc2ccc(S(=O)(=O)NCC3CCCO3)cc2)cc(OCC)c1OCC |
| InChI | InChI=1S/C24H32N2O7S/c1-4-30-21-14-17(15-22(31-5-2)23(21)32-6-3)24(27)26-18-9-11-20(12-10-18)34(28,29)25-16-19-8-7-13-33-19/h9-12,14-15,19,25H,4-8,13,16H2,1-3H3,(H,26,27) |
| InChIKey | MQRUGBRETDLLLQ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.59 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |