C21H25BrN2O6S — CID 17161225
3-bromo-4-(2-methoxyethoxy)-N-[4-(oxolan-2-ylmethylsulfamoyl)phenyl]benzamide (PubChem CID 17161225) has the molecular formula C21H25BrN2O6S and a molecular weight of 513.41 g/mol. Its IUPAC name is 3-bromo-4-(2-methoxyethoxy)-N-[4-(oxolan-2-ylmethylsulfamoyl)phenyl]benzamide.
| Compound Name | 3-bromo-4-(2-methoxyethoxy)-N-[4-(oxolan-2-ylmethylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 17161225 |
| Molecular Formula | C21H25BrN2O6S |
| Molecular Weight | 513.41 g/mol |
| Exact Mass | 512.06 |
| IUPAC Name | 3-bromo-4-(2-methoxyethoxy)-N-[4-(oxolan-2-ylmethylsulfamoyl)phenyl]benzamide |
| SMILES | COCCOc1ccc(C(=O)Nc2ccc(S(=O)(=O)NCC3CCCO3)cc2)cc1Br |
| InChI | InChI=1S/C21H25BrN2O6S/c1-28-11-12-30-20-9-4-15(13-19(20)22)21(25)24-16-5-7-18(8-6-16)31(26,27)23-14-17-3-2-10-29-17/h4-9,13,17,23H,2-3,10-12,14H2,1H3,(H,24,25) |
| InChIKey | ZDJGYUMIIXQBPO-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.41 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|