C20H23BrN2O5S — CID 17161178
2-(2-bromo-4-methylphenoxy)-N-[4-(oxolan-2-ylmethylsulfamoyl)phenyl]acetamide (PubChem CID 17161178) has the molecular formula C20H23BrN2O5S and a molecular weight of 483.38 g/mol. Its IUPAC name is 2-(2-bromo-4-methylphenoxy)-N-[4-(oxolan-2-ylmethylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-(2-bromo-4-methylphenoxy)-N-[4-(oxolan-2-ylmethylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 17161178 |
| Molecular Formula | C20H23BrN2O5S |
| Molecular Weight | 483.38 g/mol |
| Exact Mass | 482.05 |
| IUPAC Name | 2-(2-bromo-4-methylphenoxy)-N-[4-(oxolan-2-ylmethylsulfamoyl)phenyl]acetamide |
| SMILES | Cc1ccc(OCC(=O)Nc2ccc(S(=O)(=O)NCC3CCCO3)cc2)c(Br)c1 |
| InChI | InChI=1S/C20H23BrN2O5S/c1-14-4-9-19(18(21)11-14)28-13-20(24)23-15-5-7-17(8-6-15)29(25,26)22-12-16-3-2-10-27-16/h4-9,11,16,22H,2-3,10,12-13H2,1H3,(H,23,24) |
| InChIKey | GSDBNSRUOAZLTF-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |