C19H21ClN2O5S — CID 17105878
2-(2-chlorophenoxy)-N-[4-(oxolan-2-ylmethylsulfamoyl)phenyl]acetamide (PubChem CID 17105878) has the molecular formula C19H21ClN2O5S and a molecular weight of 424.91 g/mol. Its IUPAC name is 2-(2-chlorophenoxy)-N-[4-(oxolan-2-ylmethylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-(2-chlorophenoxy)-N-[4-(oxolan-2-ylmethylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 17105878 |
| Molecular Formula | C19H21ClN2O5S |
| Molecular Weight | 424.91 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | 2-(2-chlorophenoxy)-N-[4-(oxolan-2-ylmethylsulfamoyl)phenyl]acetamide |
| SMILES | O=C(COc1ccccc1Cl)Nc1ccc(S(=O)(=O)NCC2CCCO2)cc1 |
| InChI | InChI=1S/C19H21ClN2O5S/c20-17-5-1-2-6-18(17)27-13-19(23)22-14-7-9-16(10-8-14)28(24,25)21-12-15-4-3-11-26-15/h1-2,5-10,15,21H,3-4,11-13H2,(H,22,23) |
| InChIKey | HGBYWCVQNYDVPC-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.91 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |