C23H24N2O5S — CID 17105928
2-naphthalen-2-yloxy-N-[4-(oxolan-2-ylmethylsulfamoyl)phenyl]acetamide (PubChem CID 17105928) has the molecular formula C23H24N2O5S and a molecular weight of 440.52 g/mol. Its IUPAC name is 2-naphthalen-2-yloxy-N-[4-(oxolan-2-ylmethylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-naphthalen-2-yloxy-N-[4-(oxolan-2-ylmethylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 17105928 |
| Molecular Formula | C23H24N2O5S |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | 2-naphthalen-2-yloxy-N-[4-(oxolan-2-ylmethylsulfamoyl)phenyl]acetamide |
| SMILES | O=C(COc1ccc2ccccc2c1)Nc1ccc(S(=O)(=O)NCC2CCCO2)cc1 |
| InChI | InChI=1S/C23H24N2O5S/c26-23(16-30-20-10-7-17-4-1-2-5-18(17)14-20)25-19-8-11-22(12-9-19)31(27,28)24-15-21-6-3-13-29-21/h1-2,4-5,7-12,14,21,24H,3,6,13,15-16H2,(H,25,26) |
| InChIKey | UQLFJSNRMUDOEH-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |