C24H24N2O4 — CID 41320310
2-[(2-naphthalen-2-yloxyacetyl)amino]-N-[[(2S)-oxolan-2-yl]methyl]benzamide (PubChem CID 41320310) has the molecular formula C24H24N2O4 and a molecular weight of 404.47 g/mol. Its IUPAC name is 2-[(2-naphthalen-2-yloxyacetyl)amino]-N-[[(2S)-oxolan-2-yl]methyl]benzamide.
| Compound Name | 2-[(2-naphthalen-2-yloxyacetyl)amino]-N-[[(2S)-oxolan-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 41320310 |
| Molecular Formula | C24H24N2O4 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 2-[(2-naphthalen-2-yloxyacetyl)amino]-N-[[(2S)-oxolan-2-yl]methyl]benzamide |
| SMILES | O=C(COc1ccc2ccccc2c1)Nc1ccccc1C(=O)NC[C@@H]1CCCO1 |
| InChI | InChI=1S/C24H24N2O4/c27-23(16-30-19-12-11-17-6-1-2-7-18(17)14-19)26-22-10-4-3-9-21(22)24(28)25-15-20-8-5-13-29-20/h1-4,6-7,9-12,14,20H,5,8,13,15-16H2,(H,25,28)(H,26,27)/t20-/m0/s1 |
| InChIKey | PONPGGQCUBUOEF-FQEVSTJZSA-N |
| XLogP | 3.77 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |