C21H23FN2O4 — CID 43059773
2-[3-(3-fluorophenoxy)propanoylamino]-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 43059773) has the molecular formula C21H23FN2O4 and a molecular weight of 386.42 g/mol. Its IUPAC name is 2-[3-(3-fluorophenoxy)propanoylamino]-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 2-[3-(3-fluorophenoxy)propanoylamino]-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 43059773 |
| Molecular Formula | C21H23FN2O4 |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 2-[3-(3-fluorophenoxy)propanoylamino]-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | O=C(CCOc1cccc(F)c1)Nc1ccccc1C(=O)NCC1CCCO1 |
| InChI | InChI=1S/C21H23FN2O4/c22-15-5-3-6-16(13-15)28-12-10-20(25)24-19-9-2-1-8-18(19)21(26)23-14-17-7-4-11-27-17/h1-3,5-6,8-9,13,17H,4,7,10-12,14H2,(H,23,26)(H,24,25) |
| InChIKey | LPBPYBPFWMFVMZ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |