C17H22N2O5 — CID 7248308
methyl 4-oxo-4-[2-[[(2R)-oxolan-2-yl]methylcarbamoyl]anilino]butanoate (PubChem CID 7248308) has the molecular formula C17H22N2O5 and a molecular weight of 334.37 g/mol. Its IUPAC name is methyl 4-oxo-4-[2-[[(2R)-oxolan-2-yl]methylcarbamoyl]anilino]butanoate.
| Compound Name | methyl 4-oxo-4-[2-[[(2R)-oxolan-2-yl]methylcarbamoyl]anilino]butanoate |
|---|---|
| PubChem CID | 7248308 |
| Molecular Formula | C17H22N2O5 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | methyl 4-oxo-4-[2-[[(2R)-oxolan-2-yl]methylcarbamoyl]anilino]butanoate |
| SMILES | COC(=O)CCC(=O)Nc1ccccc1C(=O)NC[C@H]1CCCO1 |
| InChI | InChI=1S/C17H22N2O5/c1-23-16(21)9-8-15(20)19-14-7-3-2-6-13(14)17(22)18-11-12-5-4-10-24-12/h2-3,6-7,12H,4-5,8-11H2,1H3,(H,18,22)(H,19,20)/t12-/m1/s1 |
| InChIKey | KZFVIIUXGIVARE-GFCCVEGCSA-N |
| XLogP | 1.49 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |