C27H28N2O3 — CID 41168092
2-(3,3-diphenylpropanoylamino)-N-[[(2S)-oxolan-2-yl]methyl]benzamide (PubChem CID 41168092) has the molecular formula C27H28N2O3 and a molecular weight of 428.53 g/mol. Its IUPAC name is 2-(3,3-diphenylpropanoylamino)-N-[[(2S)-oxolan-2-yl]methyl]benzamide.
| Compound Name | 2-(3,3-diphenylpropanoylamino)-N-[[(2S)-oxolan-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 41168092 |
| Molecular Formula | C27H28N2O3 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 2-(3,3-diphenylpropanoylamino)-N-[[(2S)-oxolan-2-yl]methyl]benzamide |
| SMILES | O=C(CC(c1ccccc1)c1ccccc1)Nc1ccccc1C(=O)NC[C@@H]1CCCO1 |
| InChI | InChI=1S/C27H28N2O3/c30-26(18-24(20-10-3-1-4-11-20)21-12-5-2-6-13-21)29-25-16-8-7-15-23(25)27(31)28-19-22-14-9-17-32-22/h1-8,10-13,15-16,22,24H,9,14,17-19H2,(H,28,31)(H,29,30)/t22-/m0/s1 |
| InChIKey | KXOIQAOVGAJFIL-QFIPXVFZSA-N |
| XLogP | 4.76 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |