C19H19BrN2O3 — CID 4935365
2-[(2-bromobenzoyl)amino]-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 4935365) has the molecular formula C19H19BrN2O3 and a molecular weight of 403.28 g/mol. Its IUPAC name is 2-[(2-bromobenzoyl)amino]-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 2-[(2-bromobenzoyl)amino]-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 4935365 |
| Molecular Formula | C19H19BrN2O3 |
| Molecular Weight | 403.28 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | 2-[(2-bromobenzoyl)amino]-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | O=C(Nc1ccccc1C(=O)NCC1CCCO1)c1ccccc1Br |
| InChI | InChI=1S/C19H19BrN2O3/c20-16-9-3-1-7-14(16)19(24)22-17-10-4-2-8-15(17)18(23)21-12-13-6-5-11-25-13/h1-4,7-10,13H,5-6,11-12H2,(H,21,23)(H,22,24) |
| InChIKey | CJGDRDMERMEPSU-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.28 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |