C23H28N2O4 — CID 17361745
N-(oxolan-2-ylmethyl)-2-[[2-(2,4,5-trimethylphenoxy)acetyl]amino]benzamide (PubChem CID 17361745) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-2-[[2-(2,4,5-trimethylphenoxy)acetyl]amino]benzamide.
| Compound Name | N-(oxolan-2-ylmethyl)-2-[[2-(2,4,5-trimethylphenoxy)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 17361745 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-2-[[2-(2,4,5-trimethylphenoxy)acetyl]amino]benzamide |
| SMILES | Cc1cc(C)c(OCC(=O)Nc2ccccc2C(=O)NCC2CCCO2)cc1C |
| InChI | InChI=1S/C23H28N2O4/c1-15-11-17(3)21(12-16(15)2)29-14-22(26)25-20-9-5-4-8-19(20)23(27)24-13-18-7-6-10-28-18/h4-5,8-9,11-12,18H,6-7,10,13-14H2,1-3H3,(H,24,27)(H,25,26) |
| InChIKey | IKBJRDKMAOHROI-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |