C20H21N3O6 — CID 17361743
2-[[2-(3-nitrophenoxy)acetyl]amino]-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 17361743) has the molecular formula C20H21N3O6 and a molecular weight of 399.40 g/mol. Its IUPAC name is 2-[[2-(3-nitrophenoxy)acetyl]amino]-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 2-[[2-(3-nitrophenoxy)acetyl]amino]-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 17361743 |
| Molecular Formula | C20H21N3O6 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 2-[[2-(3-nitrophenoxy)acetyl]amino]-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | O=C(COc1cccc([N+](=O)[O-])c1)Nc1ccccc1C(=O)NCC1CCCO1 |
| InChI | InChI=1S/C20H21N3O6/c24-19(13-29-15-6-3-5-14(11-15)23(26)27)22-18-9-2-1-8-17(18)20(25)21-12-16-7-4-10-28-16/h1-3,5-6,8-9,11,16H,4,7,10,12-13H2,(H,21,25)(H,22,24) |
| InChIKey | BTZDGACKZPWEQA-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|