C21H24BrNO4 — CID 40965378
2-(2-bromo-4-ethylphenoxy)-N-[4-[[(2S)-oxolan-2-yl]methoxy]phenyl]acetamide (PubChem CID 40965378) has the molecular formula C21H24BrNO4 and a molecular weight of 434.33 g/mol. Its IUPAC name is 2-(2-bromo-4-ethylphenoxy)-N-[4-[[(2S)-oxolan-2-yl]methoxy]phenyl]acetamide.
| Compound Name | 2-(2-bromo-4-ethylphenoxy)-N-[4-[[(2S)-oxolan-2-yl]methoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 40965378 |
| Molecular Formula | C21H24BrNO4 |
| Molecular Weight | 434.33 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | 2-(2-bromo-4-ethylphenoxy)-N-[4-[[(2S)-oxolan-2-yl]methoxy]phenyl]acetamide |
| SMILES | CCc1ccc(OCC(=O)Nc2ccc(OC[C@@H]3CCCO3)cc2)c(Br)c1 |
| InChI | InChI=1S/C21H24BrNO4/c1-2-15-5-10-20(19(22)12-15)27-14-21(24)23-16-6-8-17(9-7-16)26-13-18-4-3-11-25-18/h5-10,12,18H,2-4,11,13-14H2,1H3,(H,23,24)/t18-/m0/s1 |
| InChIKey | SJYNLTDTZHPKKM-SFHVURJKSA-N |
| XLogP | 4.59 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.33 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |