C19H19BrClNO4 — CID 40796730
2-(2-bromo-4-chlorophenoxy)-N-[4-[[(2S)-oxolan-2-yl]methoxy]phenyl]acetamide (PubChem CID 40796730) has the molecular formula C19H19BrClNO4 and a molecular weight of 440.72 g/mol. Its IUPAC name is 2-(2-bromo-4-chlorophenoxy)-N-[4-[[(2S)-oxolan-2-yl]methoxy]phenyl]acetamide.
| Compound Name | 2-(2-bromo-4-chlorophenoxy)-N-[4-[[(2S)-oxolan-2-yl]methoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 40796730 |
| Molecular Formula | C19H19BrClNO4 |
| Molecular Weight | 440.72 g/mol |
| Exact Mass | 439.02 |
| IUPAC Name | 2-(2-bromo-4-chlorophenoxy)-N-[4-[[(2S)-oxolan-2-yl]methoxy]phenyl]acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1Br)Nc1ccc(OC[C@@H]2CCCO2)cc1 |
| InChI | InChI=1S/C19H19BrClNO4/c20-17-10-13(21)3-8-18(17)26-12-19(23)22-14-4-6-15(7-5-14)25-11-16-2-1-9-24-16/h3-8,10,16H,1-2,9,11-12H2,(H,22,23)/t16-/m0/s1 |
| InChIKey | WKHITHFVPTYJNN-INIZCTEOSA-N |
| XLogP | 4.68 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.72 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |