C25H31N3O4 — CID 17321471
2-[[3-(2-ethylbutanoylamino)benzoyl]amino]-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 17321471) has the molecular formula C25H31N3O4 and a molecular weight of 437.54 g/mol. Its IUPAC name is 2-[[3-(2-ethylbutanoylamino)benzoyl]amino]-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 2-[[3-(2-ethylbutanoylamino)benzoyl]amino]-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 17321471 |
| Molecular Formula | C25H31N3O4 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | 2-[[3-(2-ethylbutanoylamino)benzoyl]amino]-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | CCC(CC)C(=O)Nc1cccc(C(=O)Nc2ccccc2C(=O)NCC2CCCO2)c1 |
| InChI | InChI=1S/C25H31N3O4/c1-3-17(4-2)23(29)27-19-10-7-9-18(15-19)24(30)28-22-13-6-5-12-21(22)25(31)26-16-20-11-8-14-32-20/h5-7,9-10,12-13,15,17,20H,3-4,8,11,14,16H2,1-2H3,(H,26,31)(H,27,29)(H,28,30) |
| InChIKey | LGUMGZKITZAPBU-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |