C21H26N2O6S2 — CID 2974345
3-benzylsulfonyl-N-[4-(oxolan-2-ylmethylsulfamoyl)phenyl]propanamide (PubChem CID 2974345) has the molecular formula C21H26N2O6S2 and a molecular weight of 466.58 g/mol. Its IUPAC name is 3-benzylsulfonyl-N-[4-(oxolan-2-ylmethylsulfamoyl)phenyl]propanamide.
| Compound Name | 3-benzylsulfonyl-N-[4-(oxolan-2-ylmethylsulfamoyl)phenyl]propanamide |
|---|---|
| PubChem CID | 2974345 |
| Molecular Formula | C21H26N2O6S2 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | 3-benzylsulfonyl-N-[4-(oxolan-2-ylmethylsulfamoyl)phenyl]propanamide |
| SMILES | O=C(CCS(=O)(=O)Cc1ccccc1)Nc1ccc(S(=O)(=O)NCC2CCCO2)cc1 |
| InChI | InChI=1S/C21H26N2O6S2/c24-21(12-14-30(25,26)16-17-5-2-1-3-6-17)23-18-8-10-20(11-9-18)31(27,28)22-15-19-7-4-13-29-19/h1-3,5-6,8-11,19,22H,4,7,12-16H2,(H,23,24) |
| InChIKey | MZAZUKGXAJOVTR-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |