C18H22N2O5S2 — CID 2963217
4-(benzylsulfonylamino)-N-(oxolan-2-ylmethyl)benzenesulfonamide (PubChem CID 2963217) has the molecular formula C18H22N2O5S2 and a molecular weight of 410.52 g/mol. Its IUPAC name is 4-(benzylsulfonylamino)-N-(oxolan-2-ylmethyl)benzenesulfonamide.
| Compound Name | 4-(benzylsulfonylamino)-N-(oxolan-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 2963217 |
| Molecular Formula | C18H22N2O5S2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 4-(benzylsulfonylamino)-N-(oxolan-2-ylmethyl)benzenesulfonamide |
| SMILES | O=S(=O)(Cc1ccccc1)Nc1ccc(S(=O)(=O)NCC2CCCO2)cc1 |
| InChI | InChI=1S/C18H22N2O5S2/c21-26(22,14-15-5-2-1-3-6-15)20-16-8-10-18(11-9-16)27(23,24)19-13-17-7-4-12-25-17/h1-3,5-6,8-11,17,19-20H,4,7,12-14H2 |
| InChIKey | SRRYGOWTWAOASC-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |