C13H20N2O5S2 — CID 25040936
4-N,4-N-dimethyl-1-N-(oxolan-2-ylmethyl)benzene-1,4-disulfonamide (PubChem CID 25040936) has the molecular formula C13H20N2O5S2 and a molecular weight of 348.45 g/mol. Its IUPAC name is 4-N,4-N-dimethyl-1-N-(oxolan-2-ylmethyl)benzene-1,4-disulfonamide.
| Compound Name | 4-N,4-N-dimethyl-1-N-(oxolan-2-ylmethyl)benzene-1,4-disulfonamide |
|---|---|
| PubChem CID | 25040936 |
| Molecular Formula | C13H20N2O5S2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 4-N,4-N-dimethyl-1-N-(oxolan-2-ylmethyl)benzene-1,4-disulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(S(=O)(=O)NCC2CCCO2)cc1 |
| InChI | InChI=1S/C13H20N2O5S2/c1-15(2)22(18,19)13-7-5-12(6-8-13)21(16,17)14-10-11-4-3-9-20-11/h5-8,11,14H,3-4,9-10H2,1-2H3 |
| InChIKey | ZYRCPTXYTORYDX-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |