C12H17NO3S2 — CID 2225767
4-methylsulfanyl-N-[[(2S)-oxolan-2-yl]methyl]benzenesulfonamide (PubChem CID 2225767) has the molecular formula C12H17NO3S2 and a molecular weight of 287.41 g/mol. Its IUPAC name is 4-methylsulfanyl-N-[[(2S)-oxolan-2-yl]methyl]benzenesulfonamide.
| Compound Name | 4-methylsulfanyl-N-[[(2S)-oxolan-2-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 2225767 |
| Molecular Formula | C12H17NO3S2 |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 4-methylsulfanyl-N-[[(2S)-oxolan-2-yl]methyl]benzenesulfonamide |
| SMILES | CSc1ccc(S(=O)(=O)NC[C@@H]2CCCO2)cc1 |
| InChI | InChI=1S/C12H17NO3S2/c1-17-11-4-6-12(7-5-11)18(14,15)13-9-10-3-2-8-16-10/h4-7,10,13H,2-3,8-9H2,1H3/t10-/m0/s1 |
| InChIKey | FXHXBLZEASVMSY-JTQLQIEISA-N |
| XLogP | 1.87 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |