C17H25NO6S2 — CID 130460889
4-(oxan-4-ylmethylsulfonyl)-N-(oxolan-2-ylmethyl)benzenesulfonamide (PubChem CID 130460889) has the molecular formula C17H25NO6S2 and a molecular weight of 403.52 g/mol. Its IUPAC name is 4-(oxan-4-ylmethylsulfonyl)-N-(oxolan-2-ylmethyl)benzenesulfonamide.
| Compound Name | 4-(oxan-4-ylmethylsulfonyl)-N-(oxolan-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 130460889 |
| Molecular Formula | C17H25NO6S2 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 4-(oxan-4-ylmethylsulfonyl)-N-(oxolan-2-ylmethyl)benzenesulfonamide |
| SMILES | O=S(=O)(CC1CCOCC1)c1ccc(S(=O)(=O)NCC2CCCO2)cc1 |
| InChI | InChI=1S/C17H25NO6S2/c19-25(20,13-14-7-10-23-11-8-14)16-3-5-17(6-4-16)26(21,22)18-12-15-2-1-9-24-15/h3-6,14-15,18H,1-2,7-13H2 |
| InChIKey | IHFMTQAUBRGLQJ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |