C20H22N2O8S — CID 55475808
(2-methoxy-5-nitrophenyl)methyl 4-(oxolan-2-ylmethylsulfamoyl)benzoate (PubChem CID 55475808) has the molecular formula C20H22N2O8S and a molecular weight of 450.47 g/mol. Its IUPAC name is (2-methoxy-5-nitrophenyl)methyl 4-(oxolan-2-ylmethylsulfamoyl)benzoate.
| Compound Name | (2-methoxy-5-nitrophenyl)methyl 4-(oxolan-2-ylmethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 55475808 |
| Molecular Formula | C20H22N2O8S |
| Molecular Weight | 450.47 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | (2-methoxy-5-nitrophenyl)methyl 4-(oxolan-2-ylmethylsulfamoyl)benzoate |
| SMILES | COc1ccc([N+](=O)[O-])cc1COC(=O)c1ccc(S(=O)(=O)NCC2CCCO2)cc1 |
| InChI | InChI=1S/C20H22N2O8S/c1-28-19-9-6-16(22(24)25)11-15(19)13-30-20(23)14-4-7-18(8-5-14)31(26,27)21-12-17-3-2-10-29-17/h4-9,11,17,21H,2-3,10,12-13H2,1H3 |
| InChIKey | KCOUYEHQTLGDKQ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 134.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.47 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|