C19H26N2O5S — CID 99799010
(4-cyano-4-methylpentyl) 4-[[(2R)-oxolan-2-yl]methylsulfamoyl]benzoate (PubChem CID 99799010) has the molecular formula C19H26N2O5S and a molecular weight of 394.49 g/mol. Its IUPAC name is (4-cyano-4-methylpentyl) 4-[[(2R)-oxolan-2-yl]methylsulfamoyl]benzoate.
| Compound Name | (4-cyano-4-methylpentyl) 4-[[(2R)-oxolan-2-yl]methylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 99799010 |
| Molecular Formula | C19H26N2O5S |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | (4-cyano-4-methylpentyl) 4-[[(2R)-oxolan-2-yl]methylsulfamoyl]benzoate |
| SMILES | CC(C)(C#N)CCCOC(=O)c1ccc(S(=O)(=O)NC[C@H]2CCCO2)cc1 |
| InChI | InChI=1S/C19H26N2O5S/c1-19(2,14-20)10-4-12-26-18(22)15-6-8-17(9-7-15)27(23,24)21-13-16-5-3-11-25-16/h6-9,16,21H,3-5,10-13H2,1-2H3/t16-/m1/s1 |
| InChIKey | DRWNNJFXFWGMGT-MRXNPFEDSA-N |
| XLogP | 2.63 |
| TPSA | 105.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|