C25H25NO7S — CID 42902801
(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl 4-(oxolan-2-ylmethylsulfamoyl)benzoate (PubChem CID 42902801) has the molecular formula C25H25NO7S and a molecular weight of 483.54 g/mol. Its IUPAC name is (2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl 4-(oxolan-2-ylmethylsulfamoyl)benzoate.
| Compound Name | (2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl 4-(oxolan-2-ylmethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 42902801 |
| Molecular Formula | C25H25NO7S |
| Molecular Weight | 483.54 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | (2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl 4-(oxolan-2-ylmethylsulfamoyl)benzoate |
| SMILES | O=C(OCc1cc(=O)oc2cc3c(cc12)CCC3)c1ccc(S(=O)(=O)NCC2CCCO2)cc1 |
| InChI | InChI=1S/C25H25NO7S/c27-24-13-19(22-11-17-3-1-4-18(17)12-23(22)33-24)15-32-25(28)16-6-8-21(9-7-16)34(29,30)26-14-20-5-2-10-31-20/h6-9,11-13,20,26H,1-5,10,14-15H2 |
| InChIKey | OQKORBSNENCYGA-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.54 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|