C22H21NO6S — CID 55326624
(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl 2-(benzenesulfonamido)propanoate (PubChem CID 55326624) has the molecular formula C22H21NO6S and a molecular weight of 427.48 g/mol. Its IUPAC name is (2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl 2-(benzenesulfonamido)propanoate.
| Compound Name | (2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl 2-(benzenesulfonamido)propanoate |
|---|---|
| PubChem CID | 55326624 |
| Molecular Formula | C22H21NO6S |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | (2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl 2-(benzenesulfonamido)propanoate |
| SMILES | CC(NS(=O)(=O)c1ccccc1)C(=O)OCc1cc(=O)oc2cc3c(cc12)CCC3 |
| InChI | InChI=1S/C22H21NO6S/c1-14(23-30(26,27)18-8-3-2-4-9-18)22(25)28-13-17-12-21(24)29-20-11-16-7-5-6-15(16)10-19(17)20/h2-4,8-12,14,23H,5-7,13H2,1H3 |
| InChIKey | UBSDGPZEWNYVQK-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|