C20H14Cl2O4 — CID 2629700
(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl 2,6-dichlorobenzoate (PubChem CID 2629700) has the molecular formula C20H14Cl2O4 and a molecular weight of 389.23 g/mol. Its IUPAC name is (2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl 2,6-dichlorobenzoate.
| Compound Name | (2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl 2,6-dichlorobenzoate |
|---|---|
| PubChem CID | 2629700 |
| Molecular Formula | C20H14Cl2O4 |
| Molecular Weight | 389.23 g/mol |
| Exact Mass | 388.03 |
| IUPAC Name | (2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl 2,6-dichlorobenzoate |
| SMILES | O=C(OCc1cc(=O)oc2cc3c(cc12)CCC3)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C20H14Cl2O4/c21-15-5-2-6-16(22)19(15)20(24)25-10-13-9-18(23)26-17-8-12-4-1-3-11(12)7-14(13)17/h2,5-9H,1,3-4,10H2 |
| InChIKey | DZWFVEKJEGNYIG-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.23 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|