C19H14Cl2O3 — CID 7185179
4-[(2,5-dichlorophenoxy)methyl]-7,8-dihydro-6H-cyclopenta[g]chromen-2-one (PubChem CID 7185179) has the molecular formula C19H14Cl2O3 and a molecular weight of 361.22 g/mol. Its IUPAC name is 4-[(2,5-dichlorophenoxy)methyl]-7,8-dihydro-6H-cyclopenta[g]chromen-2-one.
| Compound Name | 4-[(2,5-dichlorophenoxy)methyl]-7,8-dihydro-6H-cyclopenta[g]chromen-2-one |
|---|---|
| PubChem CID | 7185179 |
| Molecular Formula | C19H14Cl2O3 |
| Molecular Weight | 361.22 g/mol |
| Exact Mass | 360.03 |
| IUPAC Name | 4-[(2,5-dichlorophenoxy)methyl]-7,8-dihydro-6H-cyclopenta[g]chromen-2-one |
| SMILES | O=c1cc(COc2cc(Cl)ccc2Cl)c2cc3c(cc2o1)CCC3 |
| InChI | InChI=1S/C19H14Cl2O3/c20-14-4-5-16(21)18(9-14)23-10-13-8-19(22)24-17-7-12-3-1-2-11(12)6-15(13)17/h4-9H,1-3,10H2 |
| InChIKey | AQXZNEQMVQRYHL-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.22 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|