C26H28O7 — CID 16540849
(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl 3,4,5-triethoxybenzoate (PubChem CID 16540849) has the molecular formula C26H28O7 and a molecular weight of 452.50 g/mol. Its IUPAC name is (2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl 3,4,5-triethoxybenzoate.
| Compound Name | (2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl 3,4,5-triethoxybenzoate |
|---|---|
| PubChem CID | 16540849 |
| Molecular Formula | C26H28O7 |
| Molecular Weight | 452.50 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | (2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl 3,4,5-triethoxybenzoate |
| SMILES | CCOc1cc(C(=O)OCc2cc(=O)oc3cc4c(cc23)CCC4)cc(OCC)c1OCC |
| InChI | InChI=1S/C26H28O7/c1-4-29-22-12-18(13-23(30-5-2)25(22)31-6-3)26(28)32-15-19-14-24(27)33-21-11-17-9-7-8-16(17)10-20(19)21/h10-14H,4-9,15H2,1-3H3 |
| InChIKey | URTYCAGXJLKZEC-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 84.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.50 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|