C18H14O5 — CID 2627936
(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl furan-2-carboxylate (PubChem CID 2627936) has the molecular formula C18H14O5 and a molecular weight of 310.31 g/mol. Its IUPAC name is (2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl furan-2-carboxylate.
| Compound Name | (2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl furan-2-carboxylate |
|---|---|
| PubChem CID | 2627936 |
| Molecular Formula | C18H14O5 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | (2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl furan-2-carboxylate |
| SMILES | O=C(OCc1cc(=O)oc2cc3c(cc12)CCC3)c1ccco1 |
| InChI | InChI=1S/C18H14O5/c19-17-9-13(10-22-18(20)15-5-2-6-21-15)14-7-11-3-1-4-12(11)8-16(14)23-17/h2,5-9H,1,3-4,10H2 |
| InChIKey | LLEPMWPGKSLPQB-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 69.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|