C23H22O4 — CID 7811290
(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl (2R)-2-phenylbutanoate (PubChem CID 7811290) has the molecular formula C23H22O4 and a molecular weight of 362.43 g/mol. Its IUPAC name is (2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl (2R)-2-phenylbutanoate.
| Compound Name | (2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl (2R)-2-phenylbutanoate |
|---|---|
| PubChem CID | 7811290 |
| Molecular Formula | C23H22O4 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | (2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl (2R)-2-phenylbutanoate |
| SMILES | CC[C@@H](C(=O)OCc1cc(=O)oc2cc3c(cc12)CCC3)c1ccccc1 |
| InChI | InChI=1S/C23H22O4/c1-2-19(15-7-4-3-5-8-15)23(25)26-14-18-13-22(24)27-21-12-17-10-6-9-16(17)11-20(18)21/h3-5,7-8,11-13,19H,2,6,9-10,14H2,1H3/t19-/m1/s1 |
| InChIKey | HMNVSFFSOBRMOX-LJQANCHMSA-N |
| XLogP | 4.52 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|